C24H34O5 — CID 158298728
propan-2-yl (10R,13S,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 158298728) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is propan-2-yl (10R,13S,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | propan-2-yl (10R,13S,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 158298728 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | propan-2-yl (10R,13S,16R,17R)-11,17-dihydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CC(C)OC(=O)[C@@]1(O)[C@H](C)CC2C3CCC4=CC(=O)C=C[C@]4(C)C3C(O)C[C@@]21C |
| InChI | InChI=1S/C24H34O5/c1-13(2)29-21(27)24(28)14(3)10-18-17-7-6-15-11-16(25)8-9-22(15,4)20(17)19(26)12-23(18,24)5/h8-9,11,13-14,17-20,26,28H,6-7,10,12H2,1-5H3/t14-,17?,18?,19?,20?,22+,23+,24+/m1/s1 |
| InChIKey | OQQNNCIGPGEVGU-ORALUTQESA-N |
| XLogP | 3.19 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |