C23H30O7 — CID 57159062
3-hydroxy-1-[(8S,9S,10R,13S,14S,16R,17S)-11,16,17-trihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]butane-1,2-dione (PubChem CID 57159062) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-hydroxy-1-[(8S,9S,10R,13S,14S,16R,17S)-11,16,17-trihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]butane-1,2-dione.
| Compound Name | 3-hydroxy-1-[(8S,9S,10R,13S,14S,16R,17S)-11,16,17-trihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]butane-1,2-dione |
|---|---|
| PubChem CID | 57159062 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 3-hydroxy-1-[(8S,9S,10R,13S,14S,16R,17S)-11,16,17-trihydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]butane-1,2-dione |
| SMILES | CC(O)C(=O)C(=O)[C@@]1(O)[C@H](O)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C23H30O7/c1-11(24)19(28)20(29)23(30)17(27)9-15-14-5-4-12-8-13(25)6-7-21(12,2)18(14)16(26)10-22(15,23)3/h6-8,11,14-18,24,26-27,30H,4-5,9-10H2,1-3H3/t11?,14-,15-,16?,17+,18+,21-,22-,23-/m0/s1 |
| InChIKey | CXZZHVWALFLYQP-HFRUTGIQSA-N |
| XLogP | 0.49 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|