C26H34ClNO9 — CID 44633243
[(9R,10S,11S,13S,16S,17R)-9-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate (PubChem CID 44633243) has the molecular formula C26H34ClNO9 and a molecular weight of 540.01 g/mol. Its IUPAC name is [(9R,10S,11S,13S,16S,17R)-9-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate.
| Compound Name | [(9R,10S,11S,13S,16S,17R)-9-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 44633243 |
| Molecular Formula | C26H34ClNO9 |
| Molecular Weight | 540.01 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | [(9R,10S,11S,13S,16S,17R)-9-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate |
| SMILES | C[C@H]1CC2C3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]2(C)[C@@]1(OC(=O)CCCO[N+](=O)[O-])C(=O)CO |
| InChI | InChI=1S/C26H34ClNO9/c1-15-11-19-18-7-6-16-12-17(30)8-9-23(16,2)25(18,27)20(31)13-24(19,3)26(15,21(32)14-29)37-22(33)5-4-10-36-28(34)35/h8-9,12,15,18-20,29,31H,4-7,10-11,13-14H2,1-3H3/t15-,18?,19?,20-,23-,24-,25-,26-/m0/s1 |
| InChIKey | MAARDXHMZMQJHX-UTJMBMSVSA-N |
| XLogP | 2.70 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.01 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|