C31H43ClO7 — CID 70348881
[(8S,9R,10S,13S,14S,17R)-17-(2-butanoyloxyacetyl)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate (PubChem CID 70348881) has the molecular formula C31H43ClO7 and a molecular weight of 563.13 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,17R)-17-(2-butanoyloxyacetyl)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate.
| Compound Name | [(8S,9R,10S,13S,14S,17R)-17-(2-butanoyloxyacetyl)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
|---|---|
| PubChem CID | 70348881 |
| Molecular Formula | C31H43ClO7 |
| Molecular Weight | 563.13 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | [(8S,9R,10S,13S,14S,17R)-17-(2-butanoyloxyacetyl)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@]1(C(=O)COC(=O)CCC)C(C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C31H43ClO7/c1-6-8-10-27(37)39-31(25(35)18-38-26(36)9-7-2)19(3)15-23-22-12-11-20-16-21(33)13-14-28(20,4)30(22,32)24(34)17-29(23,31)5/h13-14,16,19,22-24,34H,6-12,15,17-18H2,1-5H3/t19?,22-,23-,24?,28-,29-,30-,31-/m0/s1 |
| InChIKey | NFSMRARIGPDXNI-ZPHWTEGJSA-N |
| XLogP | 5.26 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.13 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|