C32H37ClO7 — CID 67924439
[2-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzoate (PubChem CID 67924439) has the molecular formula C32H37ClO7 and a molecular weight of 569.09 g/mol. Its IUPAC name is [2-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzoate.
| Compound Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzoate |
|---|---|
| PubChem CID | 67924439 |
| Molecular Formula | C32H37ClO7 |
| Molecular Weight | 569.09 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17S)-9-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-17-propanoyloxy-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] benzoate |
| SMILES | CCC(=O)O[C@@]1(C(=O)COC(=O)c2ccccc2)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C32H37ClO7/c1-5-27(37)40-32(26(36)18-39-28(38)20-9-7-6-8-10-20)19(2)15-24-23-12-11-21-16-22(34)13-14-29(21,3)31(23,33)25(35)17-30(24,32)4/h6-10,13-14,16,19,23-25,35H,5,11-12,15,17-18H2,1-4H3/t19-,23+,24+,25+,29+,30+,31+,32-/m1/s1 |
| InChIKey | DILMAUVGUNTXJA-QTGAPEOBSA-N |
| XLogP | 4.99 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.09 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|