C30H41ClO9 — CID 22813729
[(8S,9R,10S,13S,14S,16R,17R)-9-chloro-11-hydroxy-17-(2-methoxycarbonyloxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentyl carbonate (PubChem CID 22813729) has the molecular formula C30H41ClO9 and a molecular weight of 581.10 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,16R,17R)-9-chloro-11-hydroxy-17-(2-methoxycarbonyloxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentyl carbonate.
| Compound Name | [(8S,9R,10S,13S,14S,16R,17R)-9-chloro-11-hydroxy-17-(2-methoxycarbonyloxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentyl carbonate |
|---|---|
| PubChem CID | 22813729 |
| Molecular Formula | C30H41ClO9 |
| Molecular Weight | 581.10 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | [(8S,9R,10S,13S,14S,16R,17R)-9-chloro-11-hydroxy-17-(2-methoxycarbonyloxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] pentyl carbonate |
| SMILES | CCCCCOC(=O)O[C@]1(C(=O)COC(=O)OC)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C30H41ClO9/c1-6-7-8-13-38-26(36)40-30(24(34)17-39-25(35)37-5)18(2)14-22-21-10-9-19-15-20(32)11-12-27(19,3)29(21,31)23(33)16-28(22,30)4/h11-12,15,18,21-23,33H,6-10,13-14,16-17H2,1-5H3/t18-,21+,22+,23?,27+,28+,29+,30+/m1/s1 |
| InChIKey | RFYCIORVLPEZBV-JJCOMAJFSA-N |
| XLogP | 5.31 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.10 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|