C29H39ClO9 — CID 22813699
[2-[(8S,9R,10S,13S,14S,16R,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-methylpropyl carbonate (PubChem CID 22813699) has the molecular formula C29H39ClO9 and a molecular weight of 567.08 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,16R,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-methylpropyl carbonate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,16R,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-methylpropyl carbonate |
|---|---|
| PubChem CID | 22813699 |
| Molecular Formula | C29H39ClO9 |
| Molecular Weight | 567.08 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,16R,17R)-9-chloro-11-hydroxy-17-methoxycarbonyloxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2-methylpropyl carbonate |
| SMILES | COC(=O)O[C@]1(C(=O)COC(=O)OCC(C)C)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@@]21C |
| InChI | InChI=1S/C29H39ClO9/c1-16(2)14-37-25(35)38-15-23(33)29(39-24(34)36-6)17(3)11-21-20-8-7-18-12-19(31)9-10-26(18,4)28(20,30)22(32)13-27(21,29)5/h9-10,12,16-17,20-22,32H,7-8,11,13-15H2,1-6H3/t17-,20+,21+,22?,26+,27+,28+,29+/m1/s1 |
| InChIKey | REHLWSOCYJPATF-DBXJORRDSA-N |
| XLogP | 4.77 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|