C31H43FO9 — CID 70585859
[2-[(8S,9R,10S,11S,13S,14S,16R,17R)-17-butoxycarbonyloxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propan-2-yl carbonate (PubChem CID 70585859) has the molecular formula C31H43FO9 and a molecular weight of 578.67 g/mol. Its IUPAC name is [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-17-butoxycarbonyloxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propan-2-yl carbonate.
| Compound Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-17-butoxycarbonyloxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 70585859 |
| Molecular Formula | C31H43FO9 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | [2-[(8S,9R,10S,11S,13S,14S,16R,17R)-17-butoxycarbonyloxy-9-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] propan-2-yl carbonate |
| SMILES | CCCCOC(=O)O[C@]1(C(=O)COC(=O)OC(C)C)[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C31H43FO9/c1-7-8-13-38-27(37)41-31(25(35)17-39-26(36)40-18(2)3)19(4)14-23-22-10-9-20-15-21(33)11-12-28(20,5)30(22,32)24(34)16-29(23,31)6/h11-12,15,18-19,22-24,34H,7-10,13-14,16-17H2,1-6H3/t19-,22+,23+,24+,28+,29+,30+,31+/m1/s1 |
| InChIKey | OHLAFSVHPAPCFU-MRUJRBFISA-N |
| XLogP | 5.43 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|