C25H35NO9 — CID 143936692
[(17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate (PubChem CID 143936692) has the molecular formula C25H35NO9 and a molecular weight of 493.55 g/mol. Its IUPAC name is [(17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate.
| Compound Name | [(17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate |
|---|---|
| PubChem CID | 143936692 |
| Molecular Formula | C25H35NO9 |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | [(17R)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-nitrooxybutanoate |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(O)CC2(C)C1CC[C@]2(OC(=O)CCCO[N+](=O)[O-])C(=O)CO |
| InChI | InChI=1S/C25H35NO9/c1-23-9-7-16(28)12-15(23)5-6-17-18-8-10-25(20(30)14-27,24(18,2)13-19(29)22(17)23)35-21(31)4-3-11-34-26(32)33/h12,17-19,22,27,29H,3-11,13-14H2,1-2H3/t17?,18?,19?,22?,23?,24?,25-/m0/s1 |
| InChIKey | QABRLBOLYVZOBJ-ZCOVJMMDSA-N |
| XLogP | 2.32 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|