C36H35NO6S — CID 3542630
[2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 2-acridin-9-ylsulfanylacetate (PubChem CID 3542630) has the molecular formula C36H35NO6S and a molecular weight of 609.74 g/mol. Its IUPAC name is [2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 2-acridin-9-ylsulfanylacetate.
| Compound Name | [2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 2-acridin-9-ylsulfanylacetate |
|---|---|
| PubChem CID | 3542630 |
| Molecular Formula | C36H35NO6S |
| Molecular Weight | 609.74 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | [2-(17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 2-acridin-9-ylsulfanylacetate |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(=O)CC2(C)C1CCC2(O)C(=O)COC(=O)CSc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C36H35NO6S/c1-34-15-13-22(38)17-21(34)11-12-23-26-14-16-36(42,35(26,2)18-29(39)32(23)34)30(40)19-43-31(41)20-44-33-24-7-3-5-9-27(24)37-28-10-6-4-8-25(28)33/h3-10,13,15,17,23,26,32,42H,11-12,14,16,18-20H2,1-2H3 |
| InChIKey | ZFMUTZBQQQAMIW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.74 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|