C21H27NaO5 — CID 174522792
sodium;hydride;(8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 174522792) has the molecular formula C21H27NaO5 and a molecular weight of 382.43 g/mol. Its IUPAC name is sodium;hydride;(8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | sodium;hydride;(8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 174522792 |
| Molecular Formula | C21H27NaO5 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | sodium;hydride;(8S,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CO.[H-].[Na+] |
| InChI | InChI=1S/C21H26O5.Na.H/c1-19-7-5-13(23)9-12(19)3-4-14-15-6-8-21(26,17(25)11-22)20(15,2)10-16(24)18(14)19;;/h5,7,9,14-15,18,22,26H,3-4,6,8,10-11H2,1-2H3;;/q;+1;-1/t14-,15-,18+,19-,20-,21-;;/m0../s1 |
| InChIKey | YYHZMQAUWYDVJR-PWEPTXNASA-N |
| XLogP | -1.12 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |