C23H27O7- — CID 91873490
3-hydroxy-4-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoate (PubChem CID 91873490) has the molecular formula C23H27O7- and a molecular weight of 415.46 g/mol. Its IUPAC name is 3-hydroxy-4-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoate.
| Compound Name | 3-hydroxy-4-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 91873490 |
| Molecular Formula | C23H27O7- |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-hydroxy-4-[(8S,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoate |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2C(=O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)C(O)CC(=O)[O-] |
| InChI | InChI=1S/C23H28O7/c1-21-7-5-13(24)9-12(21)3-4-14-15-6-8-23(30,20(29)16(25)10-18(27)28)22(15,2)11-17(26)19(14)21/h5,7,9,14-16,19,25,30H,3-4,6,8,10-11H2,1-2H3,(H,27,28)/p-1/t14-,15-,16?,19+,21-,22-,23-/m0/s1 |
| InChIKey | TXDOVRNIKOZCCE-HAOVLUDHSA-M |
| XLogP | 0.27 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |