C24H33O6P — CID 142963621
17-(ethoxyphosphanylmethoxy)-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 142963621) has the molecular formula C24H33O6P and a molecular weight of 448.50 g/mol. Its IUPAC name is 17-(ethoxyphosphanylmethoxy)-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | 17-(ethoxyphosphanylmethoxy)-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 142963621 |
| Molecular Formula | C24H33O6P |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 17-(ethoxyphosphanylmethoxy)-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CCOPCOC1(C(=O)CO)CCC2C3CCC4=CC(=O)C=CC4(C)C3C(=O)CC21C |
| InChI | InChI=1S/C24H33O6P/c1-4-30-31-14-29-24(20(28)13-25)10-8-18-17-6-5-15-11-16(26)7-9-22(15,2)21(17)19(27)12-23(18,24)3/h7,9,11,17-18,21,25,31H,4-6,8,10,12-14H2,1-3H3 |
| InChIKey | WCTZICFOKOPFPJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|