C25H32O6 — CID 124901614
(2R,4R,8'S,9'R,10'R,13'S,14'R)-2-ethoxy-2,10',13'-trimethylspiro[1,3-dioxane-4,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-3',5,11'-trione (PubChem CID 124901614) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is (2R,4R,8'S,9'R,10'R,13'S,14'R)-2-ethoxy-2,10',13'-trimethylspiro[1,3-dioxane-4,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-3',5,11'-trione.
| Compound Name | (2R,4R,8'S,9'R,10'R,13'S,14'R)-2-ethoxy-2,10',13'-trimethylspiro[1,3-dioxane-4,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-3',5,11'-trione |
|---|---|
| PubChem CID | 124901614 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (2R,4R,8'S,9'R,10'R,13'S,14'R)-2-ethoxy-2,10',13'-trimethylspiro[1,3-dioxane-4,17'-6,7,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene]-3',5,11'-trione |
| SMILES | CCO[C@]1(C)OCC(=O)[C@]2(CC[C@@H]3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)[C@@H]4C(=O)C[C@@]32C)O1 |
| InChI | InChI=1S/C25H32O6/c1-5-29-24(4)30-14-20(28)25(31-24)11-9-18-17-7-6-15-12-16(26)8-10-22(15,2)21(17)19(27)13-23(18,25)3/h8,10,12,17-18,21H,5-7,9,11,13-14H2,1-4H3/t17-,18+,21-,22-,23-,24+,25-/m0/s1 |
| InChIKey | KPMVTEIRVTYPFF-NCUJVRQOSA-N |
| XLogP | 3.54 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |