C27H38O9S — CID 22813914
[2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate (PubChem CID 22813914) has the molecular formula C27H38O9S and a molecular weight of 538.66 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate |
|---|---|
| PubChem CID | 22813914 |
| Molecular Formula | C27H38O9S |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] methanesulfonate |
| SMILES | CCCCOC(=O)O[C@]1(C(=O)COS(C)(=O)=O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C27H38O9S/c1-5-6-13-34-24(31)36-27(22(30)16-35-37(4,32)33)12-10-20-19-8-7-17-14-18(28)9-11-25(17,2)23(19)21(29)15-26(20,27)3/h14,19-20,23H,5-13,15-16H2,1-4H3/t19-,20-,23+,25-,26-,27-/m0/s1 |
| InChIKey | MBWZJBCWEJPKGG-FWJOXNLTSA-N |
| XLogP | 3.93 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|