C29H33ClO9S — CID 88777729
[2-[(8S,9S,10R,13S,14S,17R)-17-methoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-chlorobenzenesulfonate (PubChem CID 88777729) has the molecular formula C29H33ClO9S and a molecular weight of 593.09 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17R)-17-methoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17R)-17-methoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 88777729 |
| Molecular Formula | C29H33ClO9S |
| Molecular Weight | 593.09 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17R)-17-methoxycarbonyloxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-chlorobenzenesulfonate |
| SMILES | COC(=O)O[C@]1(C(=O)COS(=O)(=O)c2ccc(Cl)cc2)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C |
| InChI | InChI=1S/C29H33ClO9S/c1-27-12-10-19(31)14-17(27)4-9-21-22-11-13-29(39-26(34)37-3,28(22,2)15-23(32)25(21)27)24(33)16-38-40(35,36)20-7-5-18(30)6-8-20/h5-8,14,21-22,25H,4,9-13,15-16H2,1-3H3/t21-,22-,25+,27-,28-,29-/m0/s1 |
| InChIKey | WDTINAFAGRSZPE-URGFCHFESA-N |
| XLogP | 4.85 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.09 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'steroid_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|