C30H40O8 — CID 22813974
[2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 22813974) has the molecular formula C30H40O8 and a molecular weight of 528.64 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] cyclopropanecarboxylate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 22813974 |
| Molecular Formula | C30H40O8 |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17R)-17-butoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | CCCCOC(=O)O[C@]1(C(=O)COC(=O)C2CC2)CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C30H40O8/c1-4-5-14-36-27(35)38-30(24(33)17-37-26(34)18-6-7-18)13-11-22-21-9-8-19-15-20(31)10-12-28(19,2)25(21)23(32)16-29(22,30)3/h10,12,15,18,21-23,25,32H,4-9,11,13-14,16-17H2,1-3H3/t21-,22-,23?,25+,28-,29-,30-/m0/s1 |
| InChIKey | FJCKZDFWUUBYSH-CHRSVJCBSA-N |
| XLogP | 4.48 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|