C23H32O3 — CID 145221616
1-[(8S,10R,13S,17S)-11-hydroxy-10,13-dimethyl-3-methylidene-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methoxyethanone (PubChem CID 145221616) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 1-[(8S,10R,13S,17S)-11-hydroxy-10,13-dimethyl-3-methylidene-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methoxyethanone.
| Compound Name | 1-[(8S,10R,13S,17S)-11-hydroxy-10,13-dimethyl-3-methylidene-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 145221616 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 1-[(8S,10R,13S,17S)-11-hydroxy-10,13-dimethyl-3-methylidene-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-methoxyethanone |
| SMILES | C=C1C=C[C@@]2(C)C(=C1)CC[C@@H]1C2C(O)C[C@@]2(C)C1CC[C@@H]2C(=O)COC |
| InChI | InChI=1S/C23H32O3/c1-14-9-10-22(2)15(11-14)5-6-16-17-7-8-18(20(25)13-26-4)23(17,3)12-19(24)21(16)22/h9-11,16-19,21,24H,1,5-8,12-13H2,2-4H3/t16-,17?,18+,19?,21?,22-,23-/m0/s1 |
| InChIKey | STORISRTZLRAMB-FFEXTLJVSA-N |
| XLogP | 4.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |