C22H32O2 — CID 142963680
(4bS,10aS,12S)-5-hydroxy-4a,6a,7,12-tetramethyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-one (PubChem CID 142963680) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (4bS,10aS,12S)-5-hydroxy-4a,6a,7,12-tetramethyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-one.
| Compound Name | (4bS,10aS,12S)-5-hydroxy-4a,6a,7,12-tetramethyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-one |
|---|---|
| PubChem CID | 142963680 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (4bS,10aS,12S)-5-hydroxy-4a,6a,7,12-tetramethyl-5,6,7,8,9,10,10a,10b,11,12-decahydro-4bH-chrysen-2-one |
| SMILES | CC1CCC[C@H]2C3C[C@H](C)C4=CC(=O)C=CC4(C)[C@H]3C(O)CC12C |
| InChI | InChI=1S/C22H32O2/c1-13-10-16-17-7-5-6-14(2)22(17,4)12-19(24)20(16)21(3)9-8-15(23)11-18(13)21/h8-9,11,13-14,16-17,19-20,24H,5-7,10,12H2,1-4H3/t13-,14?,16?,17-,19?,20+,21?,22?/m0/s1 |
| InChIKey | FQSJBTJWJBSNOU-RWSBONDASA-N |
| XLogP | 4.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |