C23H32O5 — CID 57243640
(8S,9S,10R,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13,16-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 57243640) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13,16-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13,16-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57243640 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13,16-tetramethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1C[C@@H]2[C@H](C(O)C[C@@]3(C)[C@H]2CC(C)[C@]3(O)C(=O)CO)[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C23H32O5/c1-12-7-15-17-8-13(2)23(28,19(27)11-24)22(17,4)10-18(26)20(15)21(3)6-5-14(25)9-16(12)21/h5-6,9,12-13,15,17-18,20,24,26,28H,7-8,10-11H2,1-4H3/t12?,13?,15-,17-,18?,20+,21-,22-,23-/m0/s1 |
| InChIKey | DWUSQKAETQMPBE-QXGVLOQJSA-N |
| XLogP | 2.05 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |