C22H29FO4 — CID 22793232
(6S,8S,9S,10R,11S,13S,14S,16R,17R)-17-acetyl-6-fluoro-11,17-dihydroxy-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 22793232) has the molecular formula C22H29FO4 and a molecular weight of 376.47 g/mol. Its IUPAC name is (6S,8S,9S,10R,11S,13S,14S,16R,17R)-17-acetyl-6-fluoro-11,17-dihydroxy-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,9S,10R,11S,13S,14S,16R,17R)-17-acetyl-6-fluoro-11,17-dihydroxy-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22793232 |
| Molecular Formula | C22H29FO4 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (6S,8S,9S,10R,11S,13S,14S,16R,17R)-17-acetyl-6-fluoro-11,17-dihydroxy-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(=O)[C@@]1(O)[C@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C22H29FO4/c1-11-7-15-14-9-17(23)16-8-13(25)5-6-20(16,3)19(14)18(26)10-21(15,4)22(11,27)12(2)24/h5-6,8,11,14-15,17-19,26-27H,7,9-10H2,1-4H3/t11-,14+,15+,17+,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | BDPYZCGQVGZNOS-XBERRTGMSA-N |
| XLogP | 2.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |