C22H27FO4S — CID 142109501
(6S,10R,11S,13S,16R,17S)-6-fluoro-17-formyl-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 142109501) has the molecular formula C22H27FO4S and a molecular weight of 406.52 g/mol. Its IUPAC name is (6S,10R,11S,13S,16R,17S)-6-fluoro-17-formyl-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (6S,10R,11S,13S,16R,17S)-6-fluoro-17-formyl-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 142109501 |
| Molecular Formula | C22H27FO4S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (6S,10R,11S,13S,16R,17S)-6-fluoro-17-formyl-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1CC2C3C[C@H](F)C4=CC(=O)C=C[C@]4(C)C3C(O)C[C@]2(C)[C@@]1(C=O)C(=O)S |
| InChI | InChI=1S/C22H27FO4S/c1-11-6-14-13-8-16(23)15-7-12(25)4-5-20(15,2)18(13)17(26)9-21(14,3)22(11,10-24)19(27)28/h4-5,7,10-11,13-14,16-18,26H,6,8-9H2,1-3H3,(H,27,28)/t11-,13?,14?,16+,17?,18?,20+,21+,22-/m1/s1 |
| InChIKey | KOKCPYQPOIIPMR-BIKMRVHBSA-N |
| XLogP | 3.10 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|