C26H29FO6S — CID 11260328
(6S,8S,9S,10R,11S,13S,14S,16R,17R)-6-fluoro-17-(furan-2-carbonyloxy)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 11260328) has the molecular formula C26H29FO6S and a molecular weight of 488.58 g/mol. Its IUPAC name is (6S,8S,9S,10R,11S,13S,14S,16R,17R)-6-fluoro-17-(furan-2-carbonyloxy)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (6S,8S,9S,10R,11S,13S,14S,16R,17R)-6-fluoro-17-(furan-2-carbonyloxy)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 11260328 |
| Molecular Formula | C26H29FO6S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | (6S,8S,9S,10R,11S,13S,14S,16R,17R)-6-fluoro-17-(furan-2-carbonyloxy)-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@H]3[C@@H](O)C[C@]2(C)[C@@]1(OC(=O)c1ccco1)C(=O)S |
| InChI | InChI=1S/C26H29FO6S/c1-13-9-16-15-11-18(27)17-10-14(28)6-7-24(17,2)21(15)19(29)12-25(16,3)26(13,23(31)34)33-22(30)20-5-4-8-32-20/h4-8,10,13,15-16,18-19,21,29H,9,11-12H2,1-3H3,(H,31,34)/t13-,15+,16+,18+,19+,21-,24+,25+,26+/m1/s1 |
| InChIKey | GHMQZVFAFPINOT-VEEKYDFLSA-N |
| XLogP | 4.10 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|