C26H27FO5S — CID 10205441
(6S,8S,10R,13S,14S,16R,17R)-6-fluoro-17-(furan-2-carbonyloxy)-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid (PubChem CID 10205441) has the molecular formula C26H27FO5S and a molecular weight of 470.56 g/mol. Its IUPAC name is (6S,8S,10R,13S,14S,16R,17R)-6-fluoro-17-(furan-2-carbonyloxy)-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid.
| Compound Name | (6S,8S,10R,13S,14S,16R,17R)-6-fluoro-17-(furan-2-carbonyloxy)-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 10205441 |
| Molecular Formula | C26H27FO5S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | (6S,8S,10R,13S,14S,16R,17R)-6-fluoro-17-(furan-2-carbonyloxy)-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioic S-acid |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)C3=CC[C@]2(C)[C@@]1(OC(=O)c1ccco1)C(=O)S |
| InChI | InChI=1S/C26H27FO5S/c1-14-11-18-16-13-20(27)19-12-15(28)6-8-24(19,2)17(16)7-9-25(18,3)26(14,23(30)33)32-22(29)21-5-4-10-31-21/h4-8,10,12,14,16,18,20H,9,11,13H2,1-3H3,(H,30,33)/t14-,16-,18+,20+,24-,25+,26+/m1/s1 |
| InChIKey | GCNJIKSBBOOHHU-PLNUZOAKSA-N |
| XLogP | 5.05 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|