C27H28F2O6S — CID 10229682
[(1S,2S,8S,10S,11S,13R,14R,15S,17R)-8-fluoro-14-(fluoromethylsulfanylcarbonyl)-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] furan-2-carboxylate (PubChem CID 10229682) has the molecular formula C27H28F2O6S and a molecular weight of 518.58 g/mol. Its IUPAC name is [(1S,2S,8S,10S,11S,13R,14R,15S,17R)-8-fluoro-14-(fluoromethylsulfanylcarbonyl)-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] furan-2-carboxylate.
| Compound Name | [(1S,2S,8S,10S,11S,13R,14R,15S,17R)-8-fluoro-14-(fluoromethylsulfanylcarbonyl)-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 10229682 |
| Molecular Formula | C27H28F2O6S |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | [(1S,2S,8S,10S,11S,13R,14R,15S,17R)-8-fluoro-14-(fluoromethylsulfanylcarbonyl)-2,13,15-trimethyl-5-oxo-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-14-yl] furan-2-carboxylate |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]34O[C@@H]4C[C@]2(C)[C@@]1(OC(=O)c1ccco1)C(=O)SCF |
| InChI | InChI=1S/C27H28F2O6S/c1-14-9-16-17-11-19(29)18-10-15(30)6-7-24(18,2)27(17)21(34-27)12-25(16,3)26(14,23(32)36-13-28)35-22(31)20-5-4-8-33-20/h4-8,10,14,16-17,19,21H,9,11-13H2,1-3H3/t14-,16+,17+,19+,21-,24+,25+,26+,27-/m1/s1 |
| InChIKey | AIZKMLUYUKAVLV-FTKNVDMPSA-N |
| XLogP | 5.00 |
| TPSA | 86.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|