C30H36F2O5S — CID 142113986
[(4R,5R,17S)-17-fluoro-5-(fluoromethylsulfanylcarbonyl)-4,6,8,10,11-pentamethyl-14-methylidene-9-oxatetracyclo[8.8.0.02,6.011,16]octadeca-12,15-dien-5-yl] furan-2-carboxylate (PubChem CID 142113986) has the molecular formula C30H36F2O5S and a molecular weight of 546.68 g/mol. Its IUPAC name is [(4R,5R,17S)-17-fluoro-5-(fluoromethylsulfanylcarbonyl)-4,6,8,10,11-pentamethyl-14-methylidene-9-oxatetracyclo[8.8.0.02,6.011,16]octadeca-12,15-dien-5-yl] furan-2-carboxylate.
| Compound Name | [(4R,5R,17S)-17-fluoro-5-(fluoromethylsulfanylcarbonyl)-4,6,8,10,11-pentamethyl-14-methylidene-9-oxatetracyclo[8.8.0.02,6.011,16]octadeca-12,15-dien-5-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 142113986 |
| Molecular Formula | C30H36F2O5S |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | [(4R,5R,17S)-17-fluoro-5-(fluoromethylsulfanylcarbonyl)-4,6,8,10,11-pentamethyl-14-methylidene-9-oxatetracyclo[8.8.0.02,6.011,16]octadeca-12,15-dien-5-yl] furan-2-carboxylate |
| SMILES | C=C1C=CC2(C)C(=C1)[C@@H](F)CC1C3C[C@@H](C)[C@](OC(=O)c4ccco4)(C(=O)SCF)C3(C)CC(C)OC12C |
| InChI | InChI=1S/C30H36F2O5S/c1-17-9-10-27(4)22(12-17)23(32)14-21-20-13-18(2)30(26(34)38-16-31,37-25(33)24-8-7-11-35-24)28(20,5)15-19(3)36-29(21,27)6/h7-12,18-21,23H,1,13-16H2,2-6H3/t18-,19?,20?,21?,23+,27?,28?,29?,30+/m1/s1 |
| InChIKey | NSCKSCDCSTWZAM-IBQMXSOASA-N |
| XLogP | 7.01 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|