C22H27FO3S — CID 88907818
S-methyl (6S,10R,13S,16R,17R)-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate (PubChem CID 88907818) has the molecular formula C22H27FO3S and a molecular weight of 390.52 g/mol. Its IUPAC name is S-methyl (6S,10R,13S,16R,17R)-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate.
| Compound Name | S-methyl (6S,10R,13S,16R,17R)-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate |
|---|---|
| PubChem CID | 88907818 |
| Molecular Formula | C22H27FO3S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | S-methyl (6S,10R,13S,16R,17R)-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17-carbothioate |
| SMILES | CSC(=O)[C@@]1(O)[C@H](C)CC2C3C[C@H](F)C4=CC(=O)C=C[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C22H27FO3S/c1-12-9-16-14-11-18(23)17-10-13(24)5-7-20(17,2)15(14)6-8-21(16,3)22(12,26)19(25)27-4/h5-7,10,12,14,16,18,26H,8-9,11H2,1-4H3/t12-,14?,16?,18+,20-,21+,22+/m1/s1 |
| InChIKey | SCJMWFKCELLZOB-ATCVLMMKSA-N |
| XLogP | 4.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|