C21H22ClFO2 — CID 13066982
(6S,8S,10R,13S,14S)-17-(2-chloroacetyl)-6-fluoro-10,13-dimethyl-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-3-one (PubChem CID 13066982) has the molecular formula C21H22ClFO2 and a molecular weight of 360.86 g/mol. Its IUPAC name is (6S,8S,10R,13S,14S)-17-(2-chloroacetyl)-6-fluoro-10,13-dimethyl-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,10R,13S,14S)-17-(2-chloroacetyl)-6-fluoro-10,13-dimethyl-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 13066982 |
| Molecular Formula | C21H22ClFO2 |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (6S,8S,10R,13S,14S)-17-(2-chloroacetyl)-6-fluoro-10,13-dimethyl-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1[C@@H](F)C[C@@H]1C2=CC[C@]2(C)C(C(=O)CCl)=CC[C@@H]12 |
| InChI | InChI=1S/C21H22ClFO2/c1-20-8-6-15-13(14(20)3-4-16(20)19(25)11-22)10-18(23)17-9-12(24)5-7-21(15,17)2/h4-7,9,13-14,18H,3,8,10-11H2,1-2H3/t13-,14-,18-,20-,21+/m0/s1 |
| InChIKey | XGJCWSYTGRWNIL-HTGGGBPZSA-N |
| XLogP | 4.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|