C26H33ClO4 — CID 22817431
[2-[(6S,8S,10R,13S,14S,16R,17S)-6-chloro-10,13,16-trimethyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate (PubChem CID 22817431) has the molecular formula C26H33ClO4 and a molecular weight of 445.00 g/mol. Its IUPAC name is [2-[(6S,8S,10R,13S,14S,16R,17S)-6-chloro-10,13,16-trimethyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate.
| Compound Name | [2-[(6S,8S,10R,13S,14S,16R,17S)-6-chloro-10,13,16-trimethyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate |
|---|---|
| PubChem CID | 22817431 |
| Molecular Formula | C26H33ClO4 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | [2-[(6S,8S,10R,13S,14S,16R,17S)-6-chloro-10,13,16-trimethyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate |
| SMILES | CCCC(=O)OCC(=O)[C@H]1[C@H](C)C[C@H]2[C@@H]3C[C@H](Cl)C4=CC(=O)C=C[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C26H33ClO4/c1-5-6-23(30)31-14-22(29)24-15(2)11-19-17-13-21(27)20-12-16(28)7-9-25(20,3)18(17)8-10-26(19,24)4/h7-9,12,15,17,19,21,24H,5-6,10-11,13-14H2,1-4H3/t15-,17-,19+,21+,24-,25-,26+/m1/s1 |
| InChIKey | WPBJIPROLDSDFJ-VTPCIXMDSA-N |
| XLogP | 5.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|