C26H34Cl2O5 — CID 70519487
[2-[(8S,9R,10S,13S,14S,17S)-6,9-dichloro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate (PubChem CID 70519487) has the molecular formula C26H34Cl2O5 and a molecular weight of 497.46 g/mol. Its IUPAC name is [2-[(8S,9R,10S,13S,14S,17S)-6,9-dichloro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate.
| Compound Name | [2-[(8S,9R,10S,13S,14S,17S)-6,9-dichloro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate |
|---|---|
| PubChem CID | 70519487 |
| Molecular Formula | C26H34Cl2O5 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | [2-[(8S,9R,10S,13S,14S,17S)-6,9-dichloro-11-hydroxy-10,13,16-trimethyl-3-oxo-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] butanoate |
| SMILES | CCCC(=O)OCC(=O)[C@H]1C(C)C[C@H]2[C@@H]3CC(Cl)C4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)C(O)C[C@]12C |
| InChI | InChI=1S/C26H34Cl2O5/c1-5-6-22(32)33-13-20(30)23-14(2)9-16-17-11-19(27)18-10-15(29)7-8-25(18,4)26(17,28)21(31)12-24(16,23)3/h7-8,10,14,16-17,19,21,23,31H,5-6,9,11-13H2,1-4H3/t14?,16-,17-,19?,21?,23+,24-,25-,26-/m0/s1 |
| InChIKey | ZNAHPOSGZQFBRA-FJOYPCRLSA-N |
| XLogP | 4.62 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|