C26H34O6 — CID 134180022
4-[2-[(10S,13S,16S,17S)-3-hydroxy-10,13,16-trimethyl-6,7,8,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid (PubChem CID 134180022) has the molecular formula C26H34O6 and a molecular weight of 442.55 g/mol. Its IUPAC name is 4-[2-[(10S,13S,16S,17S)-3-hydroxy-10,13,16-trimethyl-6,7,8,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[(10S,13S,16S,17S)-3-hydroxy-10,13,16-trimethyl-6,7,8,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134180022 |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 4-[2-[(10S,13S,16S,17S)-3-hydroxy-10,13,16-trimethyl-6,7,8,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]-4-oxobutanoic acid |
| SMILES | C[C@H]1CC2C3CCC4=CC(O)C=C[C@]4(C)C3=CC[C@]2(C)[C@H]1C(=O)COC(=O)CCC(=O)O |
| InChI | InChI=1S/C26H34O6/c1-15-12-20-18-5-4-16-13-17(27)8-10-25(16,2)19(18)9-11-26(20,3)24(15)21(28)14-32-23(31)7-6-22(29)30/h8-10,13,15,17-18,20,24,27H,4-7,11-12,14H2,1-3H3,(H,29,30)/t15-,17?,18?,20?,24+,25-,26-/m0/s1 |
| InChIKey | WIPZRBBZMDXVJU-CLXBZREKSA-N |
| XLogP | 3.85 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|