C21H29NO3 — CID 66708403
[(3S,8S,10S,13S,14S,16R,17R)-17-amino-3-hydroxy-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 66708403) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is [(3S,8S,10S,13S,14S,16R,17R)-17-amino-3-hydroxy-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(3S,8S,10S,13S,14S,16R,17R)-17-amino-3-hydroxy-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 66708403 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | [(3S,8S,10S,13S,14S,16R,17R)-17-amino-3-hydroxy-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydro-3H-cyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2[C@@H]3CCC4=C[C@@H](O)C=C[C@]4(C)C3=CC[C@]2(C)[C@H]1N |
| InChI | InChI=1S/C21H29NO3/c1-12(23)25-18-11-17-15-5-4-13-10-14(24)6-8-20(13,2)16(15)7-9-21(17,3)19(18)22/h6-8,10,14-15,17-19,24H,4-5,9,11,22H2,1-3H3/t14-,15+,17-,18+,19-,20-,21-/m0/s1 |
| InChIKey | FBCCDRPXGQUOKI-ZYJDFEQASA-N |
| XLogP | 2.88 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|