C25H30O6 — CID 67664147
(8S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one;but-2-enedioic acid (PubChem CID 67664147) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is (8S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one;but-2-enedioic acid.
| Compound Name | (8S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one;but-2-enedioic acid |
|---|---|
| PubChem CID | 67664147 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (8S,10S,13S,14S,17S)-17-acetyl-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one;but-2-enedioic acid |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3=CC[C@]12C.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C21H26O2.C4H4O4/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3;5-3(6)1-2-4(7)8/h8-10,12,16-18H,4-7,11H2,1-3H3;1-2H,(H,5,6)(H,7,8)/t16-,17+,18-,20-,21+;/m0./s1 |
| InChIKey | ISRMCIRJIJHHAQ-RMXUVDIPSA-N |
| XLogP | 4.13 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|