C20H23NO2 — CID 141429216
2-[(8S,10S,13R,14S,17R)-17-hydroxy-10-methyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-13-yl]acetonitrile (PubChem CID 141429216) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[(8S,10S,13R,14S,17R)-17-hydroxy-10-methyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-13-yl]acetonitrile.
| Compound Name | 2-[(8S,10S,13R,14S,17R)-17-hydroxy-10-methyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-13-yl]acetonitrile |
|---|---|
| PubChem CID | 141429216 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-[(8S,10S,13R,14S,17R)-17-hydroxy-10-methyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-13-yl]acetonitrile |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@@H]1C2=CC[C@]2(CC#N)[C@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C20H23NO2/c1-19-8-6-14(22)12-13(19)2-3-15-16(19)7-9-20(10-11-21)17(15)4-5-18(20)23/h6-8,12,15,17-18,23H,2-5,9-10H2,1H3/t15-,17+,18-,19+,20-/m1/s1 |
| InChIKey | ILFMIWMTZBGHJF-MTEHYEEQSA-N |
| XLogP | 3.47 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|