C18H22O3 — CID 18436641
10,17-dihydroxy-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 18436641) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 10,17-dihydroxy-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 10,17-dihydroxy-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 18436641 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 10,17-dihydroxy-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC12CC=C3C(CCC4=CC(=O)C=CC43O)C1CCC2O |
| InChI | InChI=1S/C18H22O3/c1-17-8-7-15-13(14(17)4-5-16(17)20)3-2-11-10-12(19)6-9-18(11,15)21/h6-7,9-10,13-14,16,20-21H,2-5,8H2,1H3 |
| InChIKey | RJBYIFYFIUPUFI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|