C21H25FO3 — CID 57289517
(8S,10R,13S,14S)-6-fluoro-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 57289517) has the molecular formula C21H25FO3 and a molecular weight of 344.43 g/mol. Its IUPAC name is (8S,10R,13S,14S)-6-fluoro-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10R,13S,14S)-6-fluoro-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57289517 |
| Molecular Formula | C21H25FO3 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (8S,10R,13S,14S)-6-fluoro-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1C(F)C[C@@H]1C2=CC[C@]2(C)C(C(=O)CO)CC[C@@H]12 |
| InChI | InChI=1S/C21H25FO3/c1-20-8-6-15-13(14(20)3-4-16(20)19(25)11-23)10-18(22)17-9-12(24)5-7-21(15,17)2/h5-7,9,13-14,16,18,23H,3-4,8,10-11H2,1-2H3/t13-,14-,16?,18?,20-,21+/m0/s1 |
| InChIKey | OJERZXBQKIFYAO-RFOKLLNISA-N |
| XLogP | 3.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|