C22H25FO3 — CID 70468257
(8S,10R,13S,14S,17R)-17-acetyl-6-fluoro-17-hydroxy-10,13-dimethyl-16-methylidene-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-3-one (PubChem CID 70468257) has the molecular formula C22H25FO3 and a molecular weight of 356.44 g/mol. Its IUPAC name is (8S,10R,13S,14S,17R)-17-acetyl-6-fluoro-17-hydroxy-10,13-dimethyl-16-methylidene-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,10R,13S,14S,17R)-17-acetyl-6-fluoro-17-hydroxy-10,13-dimethyl-16-methylidene-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 70468257 |
| Molecular Formula | C22H25FO3 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (8S,10R,13S,14S,17R)-17-acetyl-6-fluoro-17-hydroxy-10,13-dimethyl-16-methylidene-6,7,8,12,14,15-hexahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C1C[C@H]2[C@@H]3CC(F)C4=CC(=O)C=C[C@]4(C)C3=CC[C@]2(C)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C22H25FO3/c1-12-9-17-15-11-19(23)18-10-14(25)5-7-20(18,3)16(15)6-8-21(17,4)22(12,26)13(2)24/h5-7,10,15,17,19,26H,1,8-9,11H2,2-4H3/t15-,17+,19?,20-,21+,22+/m1/s1 |
| InChIKey | VYUIYFCVAWYPBH-GULXKYHOSA-N |
| XLogP | 3.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|