C24H34O2 — CID 145224577
(6S,10R,13S,17R)-6,10,13,17-tetramethyl-17-propan-2-yloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 145224577) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is (6S,10R,13S,17R)-6,10,13,17-tetramethyl-17-propan-2-yloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,10R,13S,17R)-6,10,13,17-tetramethyl-17-propan-2-yloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 145224577 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | (6S,10R,13S,17R)-6,10,13,17-tetramethyl-17-propan-2-yloxy-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)O[C@]1(C)CCC2C3C[C@H](C)C4=CC(=O)C=C[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C24H34O2/c1-15(2)26-24(6)12-9-20-18-13-16(3)21-14-17(25)7-10-22(21,4)19(18)8-11-23(20,24)5/h7-8,10,14-16,18,20H,9,11-13H2,1-6H3/t16-,18?,20?,22+,23-,24+/m0/s1 |
| InChIKey | DCFVCOHKLNRIDH-KGCWEAHRSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|