C25H36O3Si — CID 169439836
(8S,10S,13S,14S,16R)-3',10,13-trimethyl-16-(trideuteriomethyl)-3'-trimethylsilyloxyspiro[7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17,2'-oxirane]-3-one (PubChem CID 169439836) has the molecular formula C25H36O3Si and a molecular weight of 415.66 g/mol. Its IUPAC name is (8S,10S,13S,14S,16R)-3',10,13-trimethyl-16-(trideuteriomethyl)-3'-trimethylsilyloxyspiro[7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17,2'-oxirane]-3-one.
| Compound Name | (8S,10S,13S,14S,16R)-3',10,13-trimethyl-16-(trideuteriomethyl)-3'-trimethylsilyloxyspiro[7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17,2'-oxirane]-3-one |
|---|---|
| PubChem CID | 169439836 |
| Molecular Formula | C25H36O3Si |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (8S,10S,13S,14S,16R)-3',10,13-trimethyl-16-(trideuteriomethyl)-3'-trimethylsilyloxyspiro[7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-17,2'-oxirane]-3-one |
| SMILES | [2H]C([2H])([2H])C1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3=CC[C@]2(C)C12OC2(C)O[Si](C)(C)C |
| InChI | InChI=1S/C25H36O3Si/c1-16-14-21-19-9-8-17-15-18(26)10-12-22(17,2)20(19)11-13-23(21,3)25(16)24(4,27-25)28-29(5,6)7/h10-12,15-16,19,21H,8-9,13-14H2,1-7H3/t16?,19-,21+,22+,23+,24?,25?/m1/s1/i1D3 |
| InChIKey | BYCQBAJHDLXXRA-KRCFOSMMSA-N |
| XLogP | 5.80 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|