C27H35NO2 — CID 56599130
(1S,2S,10S,14S,15R,16S,17R,19R,21S,24S)-10,14,16,21-tetramethyl-18-oxa-23-azaheptacyclo[12.11.0.02,11.05,10.015,24.017,19.017,23]pentacosa-5,8,11-trien-7-one (PubChem CID 56599130) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is (1S,2S,10S,14S,15R,16S,17R,19R,21S,24S)-10,14,16,21-tetramethyl-18-oxa-23-azaheptacyclo[12.11.0.02,11.05,10.015,24.017,19.017,23]pentacosa-5,8,11-trien-7-one.
| Compound Name | (1S,2S,10S,14S,15R,16S,17R,19R,21S,24S)-10,14,16,21-tetramethyl-18-oxa-23-azaheptacyclo[12.11.0.02,11.05,10.015,24.017,19.017,23]pentacosa-5,8,11-trien-7-one |
|---|---|
| PubChem CID | 56599130 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (1S,2S,10S,14S,15R,16S,17R,19R,21S,24S)-10,14,16,21-tetramethyl-18-oxa-23-azaheptacyclo[12.11.0.02,11.05,10.015,24.017,19.017,23]pentacosa-5,8,11-trien-7-one |
| SMILES | C[C@H]1C[C@H]2O[C@]23[C@@H](C)[C@H]2[C@H](C[C@H]4[C@@H]5CCC6=CC(=O)C=C[C@]6(C)C5=CC[C@]24C)N3C1 |
| InChI | InChI=1S/C27H35NO2/c1-15-11-23-27(30-23)16(2)24-22(28(27)14-15)13-21-19-6-5-17-12-18(29)7-9-25(17,3)20(19)8-10-26(21,24)4/h7-9,12,15-16,19,21-24H,5-6,10-11,13-14H2,1-4H3/t15-,16-,19+,21-,22-,23+,24-,25-,26-,27+/m0/s1 |
| InChIKey | WMTRIRCBLPHXBU-IWDSGUOSSA-N |
| XLogP | 4.90 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|