C22H31FO2 — CID 70348012
(6S,8S,10R,13S,14S,16S,17R)-6-fluoro-17-(2-hydroxyethyl)-10,13,16-trimethyl-3,6,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ol (PubChem CID 70348012) has the molecular formula C22H31FO2 and a molecular weight of 346.49 g/mol. Its IUPAC name is (6S,8S,10R,13S,14S,16S,17R)-6-fluoro-17-(2-hydroxyethyl)-10,13,16-trimethyl-3,6,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ol.
| Compound Name | (6S,8S,10R,13S,14S,16S,17R)-6-fluoro-17-(2-hydroxyethyl)-10,13,16-trimethyl-3,6,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 70348012 |
| Molecular Formula | C22H31FO2 |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (6S,8S,10R,13S,14S,16S,17R)-6-fluoro-17-(2-hydroxyethyl)-10,13,16-trimethyl-3,6,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CCC=C[C@]4(C)C3=CC[C@]2(C)[C@@]1(O)CCO |
| InChI | InChI=1S/C22H31FO2/c1-14-12-18-15-13-19(23)17-6-4-5-8-20(17,2)16(15)7-9-21(18,3)22(14,25)10-11-24/h5-8,14-15,18-19,24-25H,4,9-13H2,1-3H3/t14-,15+,18-,19-,20+,21-,22+/m0/s1 |
| InChIKey | AWEWLQVCSJQRPV-NUDLKYRPSA-N |
| XLogP | 4.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|