C22H28FNa2O7P — CID 70362329
disodium;[2-[(6S,10R,13S,16S,17R)-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate (PubChem CID 70362329) has the molecular formula C22H28FNa2O7P and a molecular weight of 500.41 g/mol. Its IUPAC name is disodium;[2-[(6S,10R,13S,16S,17R)-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate.
| Compound Name | disodium;[2-[(6S,10R,13S,16S,17R)-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate |
|---|---|
| PubChem CID | 70362329 |
| Molecular Formula | C22H28FNa2O7P |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | disodium;[2-[(6S,10R,13S,16S,17R)-6-fluoro-17-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] phosphate |
| SMILES | C[C@H]1CC2C3C[C@H](F)C4=CC(=O)CC[C@]4(C)C3=CC[C@]2(C)[C@@]1(O)C(=O)COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C22H30FO7P.2Na/c1-12-8-16-14-10-18(23)17-9-13(24)4-6-20(17,2)15(14)5-7-21(16,3)22(12,26)19(25)11-30-31(27,28)29;;/h5,9,12,14,16,18,26H,4,6-8,10-11H2,1-3H3,(H2,27,28,29);;/q;2*+1/p-2/t12-,14?,16?,18-,20+,21-,22-;;/m0../s1 |
| InChIKey | UCSRQKCZRSEFHY-QKDKDWGBSA-L |
| XLogP | -4.21 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|