C25H35NO4 — CID 77430504
[2-oxo-2-(10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl] 2-aminoacetate (PubChem CID 77430504) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is [2-oxo-2-(10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl] 2-aminoacetate.
| Compound Name | [2-oxo-2-(10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl] 2-aminoacetate |
|---|---|
| PubChem CID | 77430504 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | [2-oxo-2-(10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethyl] 2-aminoacetate |
| SMILES | CC1CC2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C1(C)C(=O)COC(=O)CN |
| InChI | InChI=1S/C25H35NO4/c1-15-11-20-18-6-5-16-12-17(27)7-9-23(16,2)19(18)8-10-24(20,3)25(15,4)21(28)14-30-22(29)13-26/h8,12,15,18,20H,5-7,9-11,13-14,26H2,1-4H3 |
| InChIKey | WKJAQDMAUFTSSN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|