C25H32O4 — CID 123963536
[2-oxo-2-(4,7,11-trimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-9,15-dienyl)ethyl] acetate (PubChem CID 123963536) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is [2-oxo-2-(4,7,11-trimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-9,15-dienyl)ethyl] acetate.
| Compound Name | [2-oxo-2-(4,7,11-trimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-9,15-dienyl)ethyl] acetate |
|---|---|
| PubChem CID | 123963536 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | [2-oxo-2-(4,7,11-trimethyl-14-oxo-6-pentacyclo[8.8.0.02,7.04,6.011,16]octadeca-9,15-dienyl)ethyl] acetate |
| SMILES | CC(=O)OCC(=O)C12CC1(C)CC1C3CCC4=CC(=O)CCC4(C)C3=CCC12C |
| InChI | InChI=1S/C25H32O4/c1-15(26)29-13-21(28)25-14-22(25,2)12-20-18-6-5-16-11-17(27)7-9-23(16,3)19(18)8-10-24(20,25)4/h8,11,18,20H,5-7,9-10,12-14H2,1-4H3 |
| InChIKey | YWOBDWZNMJPWIE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|