C27H36O6 — CID 77431203
4-oxo-4-[2-oxo-2-(10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethoxy]butanoic acid (PubChem CID 77431203) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is 4-oxo-4-[2-oxo-2-(10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethoxy]butanoic acid.
| Compound Name | 4-oxo-4-[2-oxo-2-(10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethoxy]butanoic acid |
|---|---|
| PubChem CID | 77431203 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 4-oxo-4-[2-oxo-2-(10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl)ethoxy]butanoic acid |
| SMILES | CC1CC2C3CCC4=CC(=O)CCC4(C)C3=CCC2(C)C1(C)C(=O)COC(=O)CCC(=O)O |
| InChI | InChI=1S/C27H36O6/c1-16-13-21-19-6-5-17-14-18(28)9-11-25(17,2)20(19)10-12-26(21,3)27(16,4)22(29)15-33-24(32)8-7-23(30)31/h10,14,16,19,21H,5-9,11-13,15H2,1-4H3,(H,30,31) |
| InChIKey | GSCAGFFTWBDUEP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|