C26H36O4 — CID 68642515
[2-oxo-2-[(10S,13S,16S,17S)-10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] propanoate (PubChem CID 68642515) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is [2-oxo-2-[(10S,13S,16S,17S)-10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] propanoate.
| Compound Name | [2-oxo-2-[(10S,13S,16S,17S)-10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] propanoate |
|---|---|
| PubChem CID | 68642515 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [2-oxo-2-[(10S,13S,16S,17S)-10,13,16,17-tetramethyl-3-oxo-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)[C@@]1(C)[C@@H](C)CC2C3CCC4=CC(=O)CC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C26H36O4/c1-6-23(29)30-15-22(28)26(5)16(2)13-21-19-8-7-17-14-18(27)9-11-24(17,3)20(19)10-12-25(21,26)4/h10,14,16,19,21H,6-9,11-13,15H2,1-5H3/t16-,19?,21?,24-,25-,26+/m0/s1 |
| InChIKey | OTCHMHHGWWKKEI-UACQRCOXSA-N |
| XLogP | 5.21 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|