C24H32O4 — CID 70351002
(6R,10R,13S,17S)-6-(hydroxymethyl)-10,13,16-trimethylspiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione (PubChem CID 70351002) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (6R,10R,13S,17S)-6-(hydroxymethyl)-10,13,16-trimethylspiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione.
| Compound Name | (6R,10R,13S,17S)-6-(hydroxymethyl)-10,13,16-trimethylspiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 70351002 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (6R,10R,13S,17S)-6-(hydroxymethyl)-10,13,16-trimethylspiro[2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| SMILES | CC1CC2C3C[C@@H](CO)C4=CC(=O)CC[C@]4(C)C3=CC[C@]2(C)[C@]12CCC(=O)O2 |
| InChI | InChI=1S/C24H32O4/c1-14-10-20-17-11-15(13-25)19-12-16(26)4-7-22(19,2)18(17)5-8-23(20,3)24(14)9-6-21(27)28-24/h5,12,14-15,17,20,25H,4,6-11,13H2,1-3H3/t14?,15-,17?,20?,22+,23-,24-/m0/s1 |
| InChIKey | JBXYBAXTWRCKJD-GWRBFLPQSA-N |
| XLogP | 3.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|