C24H30O3 — CID 143903480
(5S,7'S,11'R)-14'-methoxy-7',11'-dimethylspiro[oxolane-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,14,16-triene]-2-one (PubChem CID 143903480) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is (5S,7'S,11'R)-14'-methoxy-7',11'-dimethylspiro[oxolane-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,14,16-triene]-2-one.
| Compound Name | (5S,7'S,11'R)-14'-methoxy-7',11'-dimethylspiro[oxolane-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,14,16-triene]-2-one |
|---|---|
| PubChem CID | 143903480 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (5S,7'S,11'R)-14'-methoxy-7',11'-dimethylspiro[oxolane-5,6'-pentacyclo[8.8.0.02,7.03,5.011,16]octadeca-9,14,16-triene]-2-one |
| SMILES | COC1=CC2=CCC3C(=CC[C@@]4(C)C3C3CC3[C@@]43CCC(=O)O3)[C@@]2(C)CC1 |
| InChI | InChI=1S/C24H30O3/c1-22-9-6-15(26-3)12-14(22)4-5-16-18(22)7-10-23(2)21(16)17-13-19(17)24(23)11-8-20(25)27-24/h4,7,12,16-17,19,21H,5-6,8-11,13H2,1-3H3/t16?,17?,19?,21?,22-,23-,24-/m0/s1 |
| InChIKey | OYBROBQHNZQNDV-UOGQDCQRSA-N |
| XLogP | 4.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|