C22H30O — CID 142813084
(10R,13S)-3-methoxy-10,13-dimethylspiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,1'-cyclopropane] (PubChem CID 142813084) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is (10R,13S)-3-methoxy-10,13-dimethylspiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,1'-cyclopropane].
| Compound Name | (10R,13S)-3-methoxy-10,13-dimethylspiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,1'-cyclopropane] |
|---|---|
| PubChem CID | 142813084 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (10R,13S)-3-methoxy-10,13-dimethylspiro[1,2,7,8,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,1'-cyclopropane] |
| SMILES | COC1=CC2=CCC3C(=CC[C@@]4(C)C3CCC43CC3)[C@@]2(C)CC1 |
| InChI | InChI=1S/C22H30O/c1-20-9-6-16(23-3)14-15(20)4-5-17-18(20)7-10-21(2)19(17)8-11-22(21)12-13-22/h4,7,14,17,19H,5-6,8-13H2,1-3H3/t17?,19?,20-,21-/m0/s1 |
| InChIKey | GNYYJKTXHVKAFI-BOWFFMLLSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|