C21H28O2 — CID 175090216
(8S,10R,13S,14S)-3-methoxy-10,13-dimethyl-2,7,8,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-17-carbaldehyde (PubChem CID 175090216) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (8S,10R,13S,14S)-3-methoxy-10,13-dimethyl-2,7,8,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-17-carbaldehyde.
| Compound Name | (8S,10R,13S,14S)-3-methoxy-10,13-dimethyl-2,7,8,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-17-carbaldehyde |
|---|---|
| PubChem CID | 175090216 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (8S,10R,13S,14S)-3-methoxy-10,13-dimethyl-2,7,8,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-17-carbaldehyde |
| SMILES | COC1=CC2=CC[C@@H]3C(=CC[C@]4(C)C(C=O)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C21H28O2/c1-20-10-8-16(23-3)12-14(20)4-6-17-18-7-5-15(13-22)21(18,2)11-9-19(17)20/h4,9,12-13,15,17-18H,5-8,10-11H2,1-3H3/t15?,17-,18-,20-,21+/m0/s1 |
| InChIKey | YJPRTLZYKAMTFH-ZJVBACAPSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|